C25H30O10S — CID 72968130
[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl] 2-acetyloxy-2-methylpropanoate (PubChem CID 72968130) has the molecular formula C25H30O10S and a molecular weight of 522.57 g/mol. Its IUPAC name is [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl] 2-acetyloxy-2-methylpropanoate.
| Compound Name | [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl] 2-acetyloxy-2-methylpropanoate |
|---|---|
| PubChem CID | 72968130 |
| Molecular Formula | C25H30O10S |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl] 2-acetyloxy-2-methylpropanoate |
| SMILES | COc1cc(OC)c(C=CS(=O)(=O)Cc2ccc(OC)c(OC(=O)C(C)(C)OC(C)=O)c2)c(OC)c1 |
| InChI | InChI=1S/C25H30O10S/c1-16(26)35-25(2,3)24(27)34-23-12-17(8-9-20(23)31-5)15-36(28,29)11-10-19-21(32-6)13-18(30-4)14-22(19)33-7/h8-14H,15H2,1-7H3 |
| InChIKey | ZZZFXHCTPLVRDV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|