C21H25NO8S — CID 11396794
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-aminoacetate (PubChem CID 11396794) has the molecular formula C21H25NO8S and a molecular weight of 451.50 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-aminoacetate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-aminoacetate |
|---|---|
| PubChem CID | 11396794 |
| Molecular Formula | C21H25NO8S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-aminoacetate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OC(=O)CN)c2)c(OC)c1 |
| InChI | InChI=1S/C21H25NO8S/c1-26-15-10-18(28-3)16(19(11-15)29-4)7-8-31(24,25)13-14-5-6-17(27-2)20(9-14)30-21(23)12-22/h5-11H,12-13,22H2,1-4H3/b8-7+ |
| InChIKey | CYIRXOWXFNZVHD-BQYQJAHWSA-N |
| XLogP | 2.17 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|