C27H38NO8S+ — CID 87270173
[carboxy-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]methyl]-triethylazanium (PubChem CID 87270173) has the molecular formula C27H38NO8S+ and a molecular weight of 536.67 g/mol. Its IUPAC name is [carboxy-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]methyl]-triethylazanium.
| Compound Name | [carboxy-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]methyl]-triethylazanium |
|---|---|
| PubChem CID | 87270173 |
| Molecular Formula | C27H38NO8S+ |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | [carboxy-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]methyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)C(C(=O)O)c1cc(CS(=O)(=O)/C=C/c2c(OC)cc(OC)cc2OC)ccc1OC |
| InChI | InChI=1S/C27H37NO8S/c1-8-28(9-2,10-3)26(27(29)30)22-15-19(11-12-23(22)34-5)18-37(31,32)14-13-21-24(35-6)16-20(33-4)17-25(21)36-7/h11-17,26H,8-10,18H2,1-7H3/p+1/b14-13+ |
| InChIKey | PSFCHYSWGFNYEM-BUHFOSPRSA-O |
| XLogP | 4.31 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|