C25H29N3O8S2 — CID 25001240
2,4-diamino-N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]benzenesulfonamide (PubChem CID 25001240) has the molecular formula C25H29N3O8S2 and a molecular weight of 563.65 g/mol. Its IUPAC name is 2,4-diamino-N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]benzenesulfonamide.
| Compound Name | 2,4-diamino-N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25001240 |
| Molecular Formula | C25H29N3O8S2 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2,4-diamino-N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]benzenesulfonamide |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(NS(=O)(=O)c3ccc(N)cc3N)c2)c(OC)c1 |
| InChI | InChI=1S/C25H29N3O8S2/c1-33-18-13-23(35-3)19(24(14-18)36-4)9-10-37(29,30)15-16-5-7-22(34-2)21(11-16)28-38(31,32)25-8-6-17(26)12-20(25)27/h5-14,28H,15,26-27H2,1-4H3/b10-9+ |
| InChIKey | IEWPRLXDJNFDKA-MDZDMXLPSA-N |
| XLogP | 3.27 |
| TPSA | 169.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|