C17H17NO6S — CID 54578536
1-methoxy-4-[[(E)-2-(4-methoxyphenyl)ethenyl]sulfonylmethyl]-2-nitrobenzene (PubChem CID 54578536) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-methoxy-4-[[(E)-2-(4-methoxyphenyl)ethenyl]sulfonylmethyl]-2-nitrobenzene.
| Compound Name | 1-methoxy-4-[[(E)-2-(4-methoxyphenyl)ethenyl]sulfonylmethyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 54578536 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-methoxy-4-[[(E)-2-(4-methoxyphenyl)ethenyl]sulfonylmethyl]-2-nitrobenzene |
| SMILES | COc1ccc(/C=C/S(=O)(=O)Cc2ccc(OC)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H17NO6S/c1-23-15-6-3-13(4-7-15)9-10-25(21,22)12-14-5-8-17(24-2)16(11-14)18(19)20/h3-11H,12H2,1-2H3/b10-9+ |
| InChIKey | LLONUMLXWGMFFQ-MDZDMXLPSA-N |
| XLogP | 3.20 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|