C25H24N2O13S2 — CID 87269951
3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]-2,4-dinitrobenzenesulfonic acid (PubChem CID 87269951) has the molecular formula C25H24N2O13S2 and a molecular weight of 624.60 g/mol. Its IUPAC name is 3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]-2,4-dinitrobenzenesulfonic acid.
| Compound Name | 3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]-2,4-dinitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 87269951 |
| Molecular Formula | C25H24N2O13S2 |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 624.07 |
| IUPAC Name | 3-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]-2,4-dinitrobenzenesulfonic acid |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(-c3c([N+](=O)[O-])ccc(S(=O)(=O)O)c3[N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C25H24N2O13S2/c1-37-16-12-21(39-3)17(22(13-16)40-4)9-10-41(32,33)14-15-5-7-20(38-2)18(11-15)24-19(26(28)29)6-8-23(42(34,35)36)25(24)27(30)31/h5-13H,14H2,1-4H3,(H,34,35,36)/b10-9+ |
| InChIKey | KWVSICRFEFMZMD-MDZDMXLPSA-N |
| XLogP | 4.04 |
| TPSA | 211.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|