C26H28O10S2 — CID 173046610
4-methoxy-2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl]benzenesulfonic acid (PubChem CID 173046610) has the molecular formula C26H28O10S2 and a molecular weight of 564.63 g/mol. Its IUPAC name is 4-methoxy-2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl]benzenesulfonic acid.
| Compound Name | 4-methoxy-2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173046610 |
| Molecular Formula | C26H28O10S2 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 4-methoxy-2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl]benzenesulfonic acid |
| SMILES | COc1cc(OC)c(C=CS(=O)(=O)Cc2ccc(OC)c(-c3cc(OC)ccc3S(=O)(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C26H28O10S2/c1-32-18-7-9-26(38(29,30)31)22(13-18)21-12-17(6-8-23(21)34-3)16-37(27,28)11-10-20-24(35-4)14-19(33-2)15-25(20)36-5/h6-15H,16H2,1-5H3,(H,29,30,31) |
| InChIKey | CDYGTSNVRYNKNB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|