C18H20O5S — CID 173091097
4-[2-[(3-ethoxy-4-methoxyphenyl)methylsulfonyl]ethenyl]phenol (PubChem CID 173091097) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-[2-[(3-ethoxy-4-methoxyphenyl)methylsulfonyl]ethenyl]phenol.
| Compound Name | 4-[2-[(3-ethoxy-4-methoxyphenyl)methylsulfonyl]ethenyl]phenol |
|---|---|
| PubChem CID | 173091097 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-[2-[(3-ethoxy-4-methoxyphenyl)methylsulfonyl]ethenyl]phenol |
| SMILES | CCOc1cc(CS(=O)(=O)C=Cc2ccc(O)cc2)ccc1OC |
| InChI | InChI=1S/C18H20O5S/c1-3-23-18-12-15(6-9-17(18)22-2)13-24(20,21)11-10-14-4-7-16(19)8-5-14/h4-12,19H,3,13H2,1-2H3 |
| InChIKey | BGQOQEAWKUXVRI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |