C19H22O9S3 — CID 175532494
[4-[[(E)-2-(4-ethylsulfonyloxy-3-hydroxyphenyl)ethenyl]sulfonylmethyl]phenyl] ethanesulfonate (PubChem CID 175532494) has the molecular formula C19H22O9S3 and a molecular weight of 490.58 g/mol. Its IUPAC name is [4-[[(E)-2-(4-ethylsulfonyloxy-3-hydroxyphenyl)ethenyl]sulfonylmethyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[(E)-2-(4-ethylsulfonyloxy-3-hydroxyphenyl)ethenyl]sulfonylmethyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 175532494 |
| Molecular Formula | C19H22O9S3 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | [4-[[(E)-2-(4-ethylsulfonyloxy-3-hydroxyphenyl)ethenyl]sulfonylmethyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(CS(=O)(=O)/C=C/c2ccc(OS(=O)(=O)CC)c(O)c2)cc1 |
| InChI | InChI=1S/C19H22O9S3/c1-3-30(23,24)27-17-8-5-16(6-9-17)14-29(21,22)12-11-15-7-10-19(18(20)13-15)28-31(25,26)4-2/h5-13,20H,3-4,14H2,1-2H3/b12-11+ |
| InChIKey | BGFUADGGGWSEEF-VAWYXSNFSA-N |
| XLogP | 2.43 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|