C24H20F2O4S2 — CID 5388092
1,4-bis[[(E)-2-(4-fluorophenyl)ethenyl]sulfonylmethyl]benzene (PubChem CID 5388092) has the molecular formula C24H20F2O4S2 and a molecular weight of 474.55 g/mol. Its IUPAC name is 1,4-bis[[(E)-2-(4-fluorophenyl)ethenyl]sulfonylmethyl]benzene.
| Compound Name | 1,4-bis[[(E)-2-(4-fluorophenyl)ethenyl]sulfonylmethyl]benzene |
|---|---|
| PubChem CID | 5388092 |
| Molecular Formula | C24H20F2O4S2 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 1,4-bis[[(E)-2-(4-fluorophenyl)ethenyl]sulfonylmethyl]benzene |
| SMILES | O=S(=O)(/C=C/c1ccc(F)cc1)Cc1ccc(CS(=O)(=O)/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H20F2O4S2/c25-23-9-5-19(6-10-23)13-15-31(27,28)17-21-1-2-22(4-3-21)18-32(29,30)16-14-20-7-11-24(26)12-8-20/h1-16H,17-18H2/b15-13+,16-14+ |
| InChIKey | KHIKAWPBFCLNAD-WXUKJITCSA-N |
| XLogP | 5.14 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |