C15H11Cl2FO2S — CID 54262996
1,2-dichloro-4-[2-(4-fluorophenyl)ethenylsulfonylmethyl]benzene (PubChem CID 54262996) has the molecular formula C15H11Cl2FO2S and a molecular weight of 345.22 g/mol. Its IUPAC name is 1,2-dichloro-4-[2-(4-fluorophenyl)ethenylsulfonylmethyl]benzene.
| Compound Name | 1,2-dichloro-4-[2-(4-fluorophenyl)ethenylsulfonylmethyl]benzene |
|---|---|
| PubChem CID | 54262996 |
| Molecular Formula | C15H11Cl2FO2S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 1,2-dichloro-4-[2-(4-fluorophenyl)ethenylsulfonylmethyl]benzene |
| SMILES | O=S(=O)(C=Cc1ccc(F)cc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2FO2S/c16-14-6-3-12(9-15(14)17)10-21(19,20)8-7-11-1-4-13(18)5-2-11/h1-9H,10H2 |
| InChIKey | REUWELJYINLTOJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |