C15H14Cl2FNO2S — CID 56512863
1-(3,4-dichlorophenyl)-N-ethyl-N-(4-fluorophenyl)methanesulfonamide (PubChem CID 56512863) has the molecular formula C15H14Cl2FNO2S and a molecular weight of 362.25 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-ethyl-N-(4-fluorophenyl)methanesulfonamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-ethyl-N-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 56512863 |
| Molecular Formula | C15H14Cl2FNO2S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-ethyl-N-(4-fluorophenyl)methanesulfonamide |
| SMILES | CCN(c1ccc(F)cc1)S(=O)(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2FNO2S/c1-2-19(13-6-4-12(18)5-7-13)22(20,21)10-11-3-8-14(16)15(17)9-11/h3-9H,2,10H2,1H3 |
| InChIKey | OVOQCSPRDNYAFM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |