C15H15Cl2NO2S — CID 55531353
N-benzyl-1-(3,4-dichlorophenyl)-N-methylmethanesulfonamide (PubChem CID 55531353) has the molecular formula C15H15Cl2NO2S and a molecular weight of 344.26 g/mol. Its IUPAC name is N-benzyl-1-(3,4-dichlorophenyl)-N-methylmethanesulfonamide.
| Compound Name | N-benzyl-1-(3,4-dichlorophenyl)-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 55531353 |
| Molecular Formula | C15H15Cl2NO2S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N-benzyl-1-(3,4-dichlorophenyl)-N-methylmethanesulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2NO2S/c1-18(10-12-5-3-2-4-6-12)21(19,20)11-13-7-8-14(16)15(17)9-13/h2-9H,10-11H2,1H3 |
| InChIKey | KOVMCMCCMMEZKA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |