C17H17Cl2NO4S — CID 112822994
methyl 4-[[(3,4-dichlorophenyl)methyl-methylsulfamoyl]methyl]benzoate (PubChem CID 112822994) has the molecular formula C17H17Cl2NO4S and a molecular weight of 402.30 g/mol. Its IUPAC name is methyl 4-[[(3,4-dichlorophenyl)methyl-methylsulfamoyl]methyl]benzoate.
| Compound Name | methyl 4-[[(3,4-dichlorophenyl)methyl-methylsulfamoyl]methyl]benzoate |
|---|---|
| PubChem CID | 112822994 |
| Molecular Formula | C17H17Cl2NO4S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | methyl 4-[[(3,4-dichlorophenyl)methyl-methylsulfamoyl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)N(C)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2NO4S/c1-20(10-13-5-8-15(18)16(19)9-13)25(22,23)11-12-3-6-14(7-4-12)17(21)24-2/h3-9H,10-11H2,1-2H3 |
| InChIKey | MCSUJOTVYAIGDH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |