C18H19Cl2NO4S2 — CID 38012048
methyl 4-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethylsulfamoylmethyl]benzoate (PubChem CID 38012048) has the molecular formula C18H19Cl2NO4S2 and a molecular weight of 448.39 g/mol. Its IUPAC name is methyl 4-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethylsulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethylsulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 38012048 |
| Molecular Formula | C18H19Cl2NO4S2 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | methyl 4-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethylsulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)NCCSCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H19Cl2NO4S2/c1-25-18(22)15-5-2-13(3-6-15)12-27(23,24)21-8-9-26-11-14-4-7-16(19)17(20)10-14/h2-7,10,21H,8-9,11-12H2,1H3 |
| InChIKey | URKDVCGJEHMYAJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|