C18H20ClNO4S2 — CID 43909343
methyl 4-[2-[(3-chlorophenyl)methylsulfanyl]ethylsulfamoylmethyl]benzoate (PubChem CID 43909343) has the molecular formula C18H20ClNO4S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is methyl 4-[2-[(3-chlorophenyl)methylsulfanyl]ethylsulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[2-[(3-chlorophenyl)methylsulfanyl]ethylsulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 43909343 |
| Molecular Formula | C18H20ClNO4S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | methyl 4-[2-[(3-chlorophenyl)methylsulfanyl]ethylsulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)NCCSCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20ClNO4S2/c1-24-18(21)16-7-5-14(6-8-16)13-26(22,23)20-9-10-25-12-15-3-2-4-17(19)11-15/h2-8,11,20H,9-10,12-13H2,1H3 |
| InChIKey | QIXKTWCUIUZTDH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|