C15H14Cl3NO2S2 — CID 3926813
2,5-dichloro-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]benzenesulfonamide (PubChem CID 3926813) has the molecular formula C15H14Cl3NO2S2 and a molecular weight of 410.78 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3926813 |
| Molecular Formula | C15H14Cl3NO2S2 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 408.95 |
| IUPAC Name | 2,5-dichloro-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCSCc1cccc(Cl)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H14Cl3NO2S2/c16-12-3-1-2-11(8-12)10-22-7-6-19-23(20,21)15-9-13(17)4-5-14(15)18/h1-5,8-9,19H,6-7,10H2 |
| InChIKey | QQDIDJTXDIQQPG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|