C23H20Cl2N2O3S3 — CID 100754404
3-[(2-chlorophenyl)methyl]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100754404) has the molecular formula C23H20Cl2N2O3S3 and a molecular weight of 539.53 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100754404 |
| Molecular Formula | C23H20Cl2N2O3S3 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | O=c1sc2cc(S(=O)(=O)NCCSCc3cccc(Cl)c3)ccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H20Cl2N2O3S3/c24-18-6-3-4-16(12-18)15-31-11-10-26-33(29,30)19-8-9-21-22(13-19)32-23(28)27(21)14-17-5-1-2-7-20(17)25/h1-9,12-13,26H,10-11,14-15H2 |
| InChIKey | KLIFQBIMRSKDSG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|