C17H18N2O3S3 — CID 100717919
N-(2-benzylsulfanylethyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100717919) has the molecular formula C17H18N2O3S3 and a molecular weight of 394.54 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-(2-benzylsulfanylethyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100717919 |
| Molecular Formula | C17H18N2O3S3 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | Cn1c(=O)sc2cc(S(=O)(=O)NCCSCc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H18N2O3S3/c1-19-15-8-7-14(11-16(15)24-17(19)20)25(21,22)18-9-10-23-12-13-5-3-2-4-6-13/h2-8,11,18H,9-10,12H2,1H3 |
| InChIKey | OCBVHJNWRWNYDG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|