C16H22N2O4S2 — CID 100720654
N-(3-cyclopentyloxypropyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100720654) has the molecular formula C16H22N2O4S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-(3-cyclopentyloxypropyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100720654 |
| Molecular Formula | C16H22N2O4S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | Cn1c(=O)sc2cc(S(=O)(=O)NCCCOC3CCCC3)ccc21 |
| InChI | InChI=1S/C16H22N2O4S2/c1-18-14-8-7-13(11-15(14)23-16(18)19)24(20,21)17-9-4-10-22-12-5-2-3-6-12/h7-8,11-12,17H,2-6,9-10H2,1H3 |
| InChIKey | HATJKTZHRVXEQD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|