C14H20N2O3S2 — CID 100724111
3-ethyl-2-oxo-N-pentyl-1,3-benzothiazole-6-sulfonamide (PubChem CID 100724111) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-ethyl-2-oxo-N-pentyl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-ethyl-2-oxo-N-pentyl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100724111 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-ethyl-2-oxo-N-pentyl-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCCCCNS(=O)(=O)c1ccc2c(c1)sc(=O)n2CC |
| InChI | InChI=1S/C14H20N2O3S2/c1-3-5-6-9-15-21(18,19)11-7-8-12-13(10-11)20-14(17)16(12)4-2/h7-8,10,15H,3-6,9H2,1-2H3 |
| InChIKey | UCVDITSIFXEXHQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|