C21H25N3O3S2 — CID 100726632
3-ethyl-N-[3-[(2S)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100726632) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 3-ethyl-N-[3-[(2S)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-ethyl-N-[3-[(2S)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100726632 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-ethyl-N-[3-[(2S)-2-methyl-2,3-dihydroindol-1-yl]propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCn1c(=O)sc2cc(S(=O)(=O)NCCCN3c4ccccc4C[C@@H]3C)ccc21 |
| InChI | InChI=1S/C21H25N3O3S2/c1-3-23-19-10-9-17(14-20(19)28-21(23)25)29(26,27)22-11-6-12-24-15(2)13-16-7-4-5-8-18(16)24/h4-5,7-10,14-15,22H,3,6,11-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | UKKOJMHVTUULFD-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|