C23H29N3O3S2 — CID 100741895
3-benzyl-N-[3-(4-methylpiperidin-1-yl)propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100741895) has the molecular formula C23H29N3O3S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is 3-benzyl-N-[3-(4-methylpiperidin-1-yl)propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-benzyl-N-[3-(4-methylpiperidin-1-yl)propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100741895 |
| Molecular Formula | C23H29N3O3S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 3-benzyl-N-[3-(4-methylpiperidin-1-yl)propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | CC1CCN(CCCNS(=O)(=O)c2ccc3c(c2)sc(=O)n3Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N3O3S2/c1-18-10-14-25(15-11-18)13-5-12-24-31(28,29)20-8-9-21-22(16-20)30-23(27)26(21)17-19-6-3-2-4-7-19/h2-4,6-9,16,18,24H,5,10-15,17H2,1H3 |
| InChIKey | OEQFKLDYTOTINW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|