C17H17FN2O3S2 — CID 100720431
N-[3-(4-fluorophenyl)propyl]-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100720431) has the molecular formula C17H17FN2O3S2 and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)propyl]-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-[3-(4-fluorophenyl)propyl]-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100720431 |
| Molecular Formula | C17H17FN2O3S2 |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[3-(4-fluorophenyl)propyl]-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | Cn1c(=O)sc2cc(S(=O)(=O)NCCCc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C17H17FN2O3S2/c1-20-15-9-8-14(11-16(15)24-17(20)21)25(22,23)19-10-2-3-12-4-6-13(18)7-5-12/h4-9,11,19H,2-3,10H2,1H3 |
| InChIKey | VYXABNVFYFQKDI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|