C12H15NOS — CID 19913098
6-butyl-3-methyl-1,3-benzothiazol-2-one (PubChem CID 19913098) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 6-butyl-3-methyl-1,3-benzothiazol-2-one.
| Compound Name | 6-butyl-3-methyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 19913098 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 6-butyl-3-methyl-1,3-benzothiazol-2-one |
| SMILES | CCCCc1ccc2c(c1)sc(=O)n2C |
| InChI | InChI=1S/C12H15NOS/c1-3-4-5-9-6-7-10-11(8-9)15-12(14)13(10)2/h6-8H,3-5H2,1-2H3 |
| InChIKey | MMPLNZLZPGXUOJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |