C17H25N3OS — CID 174300896
6-[2-[3-iminohexyl(methyl)amino]ethyl]-3-methyl-1,3-benzothiazol-2-one (PubChem CID 174300896) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is 6-[2-[3-iminohexyl(methyl)amino]ethyl]-3-methyl-1,3-benzothiazol-2-one.
| Compound Name | 6-[2-[3-iminohexyl(methyl)amino]ethyl]-3-methyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 174300896 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 6-[2-[3-iminohexyl(methyl)amino]ethyl]-3-methyl-1,3-benzothiazol-2-one |
| SMILES | [H]/N=C(\CCC)CCN(C)CCc1ccc2c(c1)sc(=O)n2C |
| InChI | InChI=1S/C17H25N3OS/c1-4-5-14(18)9-11-19(2)10-8-13-6-7-15-16(12-13)22-17(21)20(15)3/h6-7,12,18H,4-5,8-11H2,1-3H3/b18-14+ |
| InChIKey | LNDPBECPVHKCLP-NBVRZTHBSA-N |
| XLogP | 3.28 |
| TPSA | 49.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|