C12H16N2OS — CID 166178372
3-methyl-6-(propylaminomethyl)-1,3-benzothiazol-2-one (PubChem CID 166178372) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-methyl-6-(propylaminomethyl)-1,3-benzothiazol-2-one.
| Compound Name | 3-methyl-6-(propylaminomethyl)-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 166178372 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-methyl-6-(propylaminomethyl)-1,3-benzothiazol-2-one |
| SMILES | CCCNCc1ccc2c(c1)sc(=O)n2C |
| InChI | InChI=1S/C12H16N2OS/c1-3-6-13-8-9-4-5-10-11(7-9)16-12(15)14(10)2/h4-5,7,13H,3,6,8H2,1-2H3 |
| InChIKey | MKKDIMXXBVTALY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|