C8H7NO4S2 — CID 3149145
3-methyl-2-oxo-1,3-benzothiazole-6-sulfonic acid (PubChem CID 3149145) has the molecular formula C8H7NO4S2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonic acid.
| Compound Name | 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonic acid |
|---|---|
| PubChem CID | 3149145 |
| Molecular Formula | C8H7NO4S2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonic acid |
| SMILES | Cn1c(=O)sc2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C8H7NO4S2/c1-9-6-3-2-5(15(11,12)13)4-7(6)14-8(9)10/h2-4H,1H3,(H,11,12,13) |
| InChIKey | RROZBAILKNTMCP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|