C16H14N2O4S2 — CID 53075004
N-(3-acetylphenyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 53075004) has the molecular formula C16H14N2O4S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-(3-acetylphenyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 53075004 |
| Molecular Formula | C16H14N2O4S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | N-(3-acetylphenyl)-3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)c2ccc3c(c2)sc(=O)n3C)c1 |
| InChI | InChI=1S/C16H14N2O4S2/c1-10(19)11-4-3-5-12(8-11)17-24(21,22)13-6-7-14-15(9-13)23-16(20)18(14)2/h3-9,17H,1-2H3 |
| InChIKey | LCKOKHBFEPQYBC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |