C8H6ClNO3S2 — CID 4912760
3-methyl-2-oxo-1,3-benzothiazole-6-sulfonyl chloride (PubChem CID 4912760) has the molecular formula C8H6ClNO3S2 and a molecular weight of 263.73 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonyl chloride.
| Compound Name | 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonyl chloride |
|---|---|
| PubChem CID | 4912760 |
| Molecular Formula | C8H6ClNO3S2 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonyl chloride |
| SMILES | Cn1c(=O)sc2cc(S(=O)(=O)Cl)ccc21 |
| InChI | InChI=1S/C8H6ClNO3S2/c1-10-6-3-2-5(15(9,12)13)4-7(6)14-8(10)11/h2-4H,1H3 |
| InChIKey | LHPLJRSBDAYNOT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |