C19H28N2 — CID 114476978
N-[[2,3-dimethyl-1-(3-methylbut-3-enyl)indol-5-yl]methyl]propan-1-amine (PubChem CID 114476978) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N-[[2,3-dimethyl-1-(3-methylbut-3-enyl)indol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2,3-dimethyl-1-(3-methylbut-3-enyl)indol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114476978 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N-[[2,3-dimethyl-1-(3-methylbut-3-enyl)indol-5-yl]methyl]propan-1-amine |
| SMILES | C=C(C)CCn1c(C)c(C)c2cc(CNCCC)ccc21 |
| InChI | InChI=1S/C19H28N2/c1-6-10-20-13-17-7-8-19-18(12-17)15(4)16(5)21(19)11-9-14(2)3/h7-8,12,20H,2,6,9-11,13H2,1,3-5H3 |
| InChIKey | SHDULXZRJNKJOB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|