C13H13FN2 — CID 12793100
3-(5-fluoro-2,3-dimethylindol-1-yl)propanenitrile (PubChem CID 12793100) has the molecular formula C13H13FN2 and a molecular weight of 216.26 g/mol. Its IUPAC name is 3-(5-fluoro-2,3-dimethylindol-1-yl)propanenitrile.
| Compound Name | 3-(5-fluoro-2,3-dimethylindol-1-yl)propanenitrile |
|---|---|
| PubChem CID | 12793100 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 3-(5-fluoro-2,3-dimethylindol-1-yl)propanenitrile |
| SMILES | Cc1c(C)n(CCC#N)c2ccc(F)cc12 |
| InChI | InChI=1S/C13H13FN2/c1-9-10(2)16(7-3-6-15)13-5-4-11(14)8-12(9)13/h4-5,8H,3,7H2,1-2H3 |
| InChIKey | QLTPABLQCRBPPJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|