C15H19FN4O — CID 82311505
3-[2-[[ethyl(2-hydroxyethyl)amino]methyl]-5-fluorobenzimidazol-1-yl]propanenitrile (PubChem CID 82311505) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is 3-[2-[[ethyl(2-hydroxyethyl)amino]methyl]-5-fluorobenzimidazol-1-yl]propanenitrile.
| Compound Name | 3-[2-[[ethyl(2-hydroxyethyl)amino]methyl]-5-fluorobenzimidazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 82311505 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-[2-[[ethyl(2-hydroxyethyl)amino]methyl]-5-fluorobenzimidazol-1-yl]propanenitrile |
| SMILES | CCN(CCO)Cc1nc2cc(F)ccc2n1CCC#N |
| InChI | InChI=1S/C15H19FN4O/c1-2-19(8-9-21)11-15-18-13-10-12(16)4-5-14(13)20(15)7-3-6-17/h4-5,10,21H,2-3,7-9,11H2,1H3 |
| InChIKey | VACSLMMYBGEUAT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |