C16H24FN3O — CID 111334193
1-[ethyl-[(1-ethyl-5-fluorobenzimidazol-2-yl)methyl]amino]-2-methylpropan-2-ol (PubChem CID 111334193) has the molecular formula C16H24FN3O and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-[ethyl-[(1-ethyl-5-fluorobenzimidazol-2-yl)methyl]amino]-2-methylpropan-2-ol.
| Compound Name | 1-[ethyl-[(1-ethyl-5-fluorobenzimidazol-2-yl)methyl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 111334193 |
| Molecular Formula | C16H24FN3O |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-[ethyl-[(1-ethyl-5-fluorobenzimidazol-2-yl)methyl]amino]-2-methylpropan-2-ol |
| SMILES | CCN(Cc1nc2cc(F)ccc2n1CC)CC(C)(C)O |
| InChI | InChI=1S/C16H24FN3O/c1-5-19(11-16(3,4)21)10-15-18-13-9-12(17)7-8-14(13)20(15)6-2/h7-9,21H,5-6,10-11H2,1-4H3 |
| InChIKey | SVTAFFAPCLEWDM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |