C14H20FN3 — CID 114285540
3-(1-ethyl-5-fluorobenzimidazol-2-yl)-3-methylbutan-1-amine (PubChem CID 114285540) has the molecular formula C14H20FN3 and a molecular weight of 249.33 g/mol. Its IUPAC name is 3-(1-ethyl-5-fluorobenzimidazol-2-yl)-3-methylbutan-1-amine.
| Compound Name | 3-(1-ethyl-5-fluorobenzimidazol-2-yl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 114285540 |
| Molecular Formula | C14H20FN3 |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3-(1-ethyl-5-fluorobenzimidazol-2-yl)-3-methylbutan-1-amine |
| SMILES | CCn1c(C(C)(C)CCN)nc2cc(F)ccc21 |
| InChI | InChI=1S/C14H20FN3/c1-4-18-12-6-5-10(15)9-11(12)17-13(18)14(2,3)7-8-16/h5-6,9H,4,7-8,16H2,1-3H3 |
| InChIKey | LXZNBXLCRLLSAN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |