C15H15FN4 — CID 86802845
1-ethyl-5-fluoro-N-(pyridin-3-ylmethyl)benzimidazol-2-amine (PubChem CID 86802845) has the molecular formula C15H15FN4 and a molecular weight of 270.31 g/mol. Its IUPAC name is 1-ethyl-5-fluoro-N-(pyridin-3-ylmethyl)benzimidazol-2-amine.
| Compound Name | 1-ethyl-5-fluoro-N-(pyridin-3-ylmethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 86802845 |
| Molecular Formula | C15H15FN4 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-ethyl-5-fluoro-N-(pyridin-3-ylmethyl)benzimidazol-2-amine |
| SMILES | CCn1c(NCc2cccnc2)nc2cc(F)ccc21 |
| InChI | InChI=1S/C15H15FN4/c1-2-20-14-6-5-12(16)8-13(14)19-15(20)18-10-11-4-3-7-17-9-11/h3-9H,2,10H2,1H3,(H,18,19) |
| InChIKey | BYGPHPVXIOTVCU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |