C21H26FN3O3 — CID 75523505
1-ethyl-5-fluoro-N-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]benzimidazol-2-amine (PubChem CID 75523505) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-ethyl-5-fluoro-N-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]benzimidazol-2-amine.
| Compound Name | 1-ethyl-5-fluoro-N-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 75523505 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-ethyl-5-fluoro-N-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]benzimidazol-2-amine |
| SMILES | CCn1c(NCc2ccc(OC)c(OCCCOC)c2)nc2cc(F)ccc21 |
| InChI | InChI=1S/C21H26FN3O3/c1-4-25-18-8-7-16(22)13-17(18)24-21(25)23-14-15-6-9-19(27-3)20(12-15)28-11-5-10-26-2/h6-9,12-13H,4-5,10-11,14H2,1-3H3,(H,23,24) |
| InChIKey | MPNSHENULOCZTD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|