C21H20F2N2 — CID 138981272
5-fluoro-3-[(5-fluoro-1,2-dimethylindol-3-yl)methyl]-1,2-dimethylindole (PubChem CID 138981272) has the molecular formula C21H20F2N2 and a molecular weight of 338.40 g/mol. Its IUPAC name is 5-fluoro-3-[(5-fluoro-1,2-dimethylindol-3-yl)methyl]-1,2-dimethylindole.
| Compound Name | 5-fluoro-3-[(5-fluoro-1,2-dimethylindol-3-yl)methyl]-1,2-dimethylindole |
|---|---|
| PubChem CID | 138981272 |
| Molecular Formula | C21H20F2N2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 5-fluoro-3-[(5-fluoro-1,2-dimethylindol-3-yl)methyl]-1,2-dimethylindole |
| SMILES | Cc1c(Cc2c(C)n(C)c3ccc(F)cc23)c2cc(F)ccc2n1C |
| InChI | InChI=1S/C21H20F2N2/c1-12-16(18-9-14(22)5-7-20(18)24(12)3)11-17-13(2)25(4)21-8-6-15(23)10-19(17)21/h5-10H,11H2,1-4H3 |
| InChIKey | TZTZAWQHIWYYOC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|