C16H22FN3 — CID 98033914
3-(1,4-diazepan-1-ylmethyl)-5-fluoro-1,2-dimethylindole (PubChem CID 98033914) has the molecular formula C16H22FN3 and a molecular weight of 275.37 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-ylmethyl)-5-fluoro-1,2-dimethylindole.
| Compound Name | 3-(1,4-diazepan-1-ylmethyl)-5-fluoro-1,2-dimethylindole |
|---|---|
| PubChem CID | 98033914 |
| Molecular Formula | C16H22FN3 |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 3-(1,4-diazepan-1-ylmethyl)-5-fluoro-1,2-dimethylindole |
| SMILES | Cc1c(CN2CCCNCC2)c2cc(F)ccc2n1C |
| InChI | InChI=1S/C16H22FN3/c1-12-15(11-20-8-3-6-18-7-9-20)14-10-13(17)4-5-16(14)19(12)2/h4-5,10,18H,3,6-9,11H2,1-2H3 |
| InChIKey | DGHPNQPLUCWQPV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|