C17H25N3 — CID 95426562
1,2-dimethyl-3-(3-piperazin-1-ylpropyl)indole (PubChem CID 95426562) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1,2-dimethyl-3-(3-piperazin-1-ylpropyl)indole.
| Compound Name | 1,2-dimethyl-3-(3-piperazin-1-ylpropyl)indole |
|---|---|
| PubChem CID | 95426562 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1,2-dimethyl-3-(3-piperazin-1-ylpropyl)indole |
| SMILES | Cc1c(CCCN2CCNCC2)c2ccccc2n1C |
| InChI | InChI=1S/C17H25N3/c1-14-15(7-5-11-20-12-9-18-10-13-20)16-6-3-4-8-17(16)19(14)2/h3-4,6,8,18H,5,7,9-13H2,1-2H3 |
| InChIKey | TXWBAOIBGSTKSR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|