C18H26N2O — CID 170870957
4-[3-(1-ethyl-2-methylindol-3-yl)propyl]morpholine (PubChem CID 170870957) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-[3-(1-ethyl-2-methylindol-3-yl)propyl]morpholine.
| Compound Name | 4-[3-(1-ethyl-2-methylindol-3-yl)propyl]morpholine |
|---|---|
| PubChem CID | 170870957 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-[3-(1-ethyl-2-methylindol-3-yl)propyl]morpholine |
| SMILES | CCn1c(C)c(CCCN2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C18H26N2O/c1-3-20-15(2)16(17-7-4-5-9-18(17)20)8-6-10-19-11-13-21-14-12-19/h4-5,7,9H,3,6,8,10-14H2,1-2H3 |
| InChIKey | GGCQHFGBMWAOHH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|