C20H30N2O — CID 170871034
4-[3-(2,7-dimethyl-1-propylindol-3-yl)propyl]morpholine (PubChem CID 170871034) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 4-[3-(2,7-dimethyl-1-propylindol-3-yl)propyl]morpholine.
| Compound Name | 4-[3-(2,7-dimethyl-1-propylindol-3-yl)propyl]morpholine |
|---|---|
| PubChem CID | 170871034 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 4-[3-(2,7-dimethyl-1-propylindol-3-yl)propyl]morpholine |
| SMILES | CCCn1c(C)c(CCCN2CCOCC2)c2cccc(C)c21 |
| InChI | InChI=1S/C20H30N2O/c1-4-10-22-17(3)18(19-8-5-7-16(2)20(19)22)9-6-11-21-12-14-23-15-13-21/h5,7-8H,4,6,9-15H2,1-3H3 |
| InChIKey | YWLKSNARFQIUIK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|