C19H27N3O3 — CID 71495168
3-butyl-1-(3-morpholin-4-ylpropyl)quinazoline-2,4-dione (PubChem CID 71495168) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-butyl-1-(3-morpholin-4-ylpropyl)quinazoline-2,4-dione.
| Compound Name | 3-butyl-1-(3-morpholin-4-ylpropyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 71495168 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-butyl-1-(3-morpholin-4-ylpropyl)quinazoline-2,4-dione |
| SMILES | CCCCn1c(=O)c2ccccc2n(CCCN2CCOCC2)c1=O |
| InChI | InChI=1S/C19H27N3O3/c1-2-3-10-22-18(23)16-7-4-5-8-17(16)21(19(22)24)11-6-9-20-12-14-25-15-13-20/h4-5,7-8H,2-3,6,9-15H2,1H3 |
| InChIKey | CJYZVEVTEUFOMV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |