C20H32N4O2 — CID 21273406
1-[6-(methylamino)hexyl]-3-(2-morpholin-4-ylethyl)benzimidazol-2-one (PubChem CID 21273406) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[6-(methylamino)hexyl]-3-(2-morpholin-4-ylethyl)benzimidazol-2-one.
| Compound Name | 1-[6-(methylamino)hexyl]-3-(2-morpholin-4-ylethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 21273406 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 1-[6-(methylamino)hexyl]-3-(2-morpholin-4-ylethyl)benzimidazol-2-one |
| SMILES | CNCCCCCCn1c(=O)n(CCN2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C20H32N4O2/c1-21-10-6-2-3-7-11-23-18-8-4-5-9-19(18)24(20(23)25)13-12-22-14-16-26-17-15-22/h4-5,8-9,21H,2-3,6-7,10-17H2,1H3 |
| InChIKey | WVAWVMRNYRWCAQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|