C20H30N4O4 — CID 69023962
N-[(3S)-1-hydroxyhexan-3-yl]-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide (PubChem CID 69023962) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[(3S)-1-hydroxyhexan-3-yl]-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide.
| Compound Name | N-[(3S)-1-hydroxyhexan-3-yl]-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 69023962 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[(3S)-1-hydroxyhexan-3-yl]-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide |
| SMILES | CCC[C@@H](CCO)NC(=O)n1c(=O)n(CCN2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C20H30N4O4/c1-2-5-16(8-13-25)21-19(26)24-18-7-4-3-6-17(18)23(20(24)27)10-9-22-11-14-28-15-12-22/h3-4,6-7,16,25H,2,5,8-15H2,1H3,(H,21,26)/t16-/m0/s1 |
| InChIKey | VCUUWZZGBONUAC-INIZCTEOSA-N |
| XLogP | 1.24 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |