C25H34N4O3 — CID 66783944
N-(1-adamantylmethyl)-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide (PubChem CID 66783944) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 66783944 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-(1-adamantylmethyl)-3-(2-morpholin-4-ylethyl)-2-oxobenzimidazole-1-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)n1c(=O)n(CCN2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C25H34N4O3/c30-23(26-17-25-14-18-11-19(15-25)13-20(12-18)16-25)29-22-4-2-1-3-21(22)28(24(29)31)6-5-27-7-9-32-10-8-27/h1-4,18-20H,5-17H2,(H,26,30) |
| InChIKey | QIUHMOUNDSEOEU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |