C25H33N3O2 — CID 72549631
1-[2-(1-adamantyl)-2-oxoethyl]-3-(2-pyrrolidin-1-ylethyl)benzimidazol-2-one (PubChem CID 72549631) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[2-(1-adamantyl)-2-oxoethyl]-3-(2-pyrrolidin-1-ylethyl)benzimidazol-2-one.
| Compound Name | 1-[2-(1-adamantyl)-2-oxoethyl]-3-(2-pyrrolidin-1-ylethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 72549631 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-[2-(1-adamantyl)-2-oxoethyl]-3-(2-pyrrolidin-1-ylethyl)benzimidazol-2-one |
| SMILES | O=C(Cn1c(=O)n(CCN2CCCC2)c2ccccc21)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H33N3O2/c29-23(25-14-18-11-19(15-25)13-20(12-18)16-25)17-28-22-6-2-1-5-21(22)27(24(28)30)10-9-26-7-3-4-8-26/h1-2,5-6,18-20H,3-4,7-17H2 |
| InChIKey | WSHJKOULHVFAAV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |