C26H37BrN4O — CID 14772822
1-(1-adamantyl)-2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]ethanone bromide (PubChem CID 14772822) has the molecular formula C26H37BrN4O and a molecular weight of 501.51 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]ethanone bromide.
| Compound Name | 1-(1-adamantyl)-2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]ethanone bromide |
|---|---|
| PubChem CID | 14772822 |
| Molecular Formula | C26H37BrN4O |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-(1-adamantyl)-2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]ethanone bromide |
| SMILES | Nc1n(CCN2CCCCC2)c2ccccc2[n+]1CC(=O)C12CC3CC(CC(C3)C1)C2.[Br-] |
| InChI | InChI=1S/C26H36N4O.BrH/c27-25-29(11-10-28-8-4-1-5-9-28)22-6-2-3-7-23(22)30(25)18-24(31)26-15-19-12-20(16-26)14-21(13-19)17-26;/h2-3,6-7,19-21,27H,1,4-5,8-18H2;1H |
| InChIKey | WSMOWZUOLORFCJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|