C25H35N4O2+ — CID 7060423
1-(1-adamantyl)-2-[2-amino-3-(2-morpholin-4-ylethyl)benzimidazol-1-ium-1-yl]ethanone (PubChem CID 7060423) has the molecular formula C25H35N4O2+ and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-[2-amino-3-(2-morpholin-4-ylethyl)benzimidazol-1-ium-1-yl]ethanone.
| Compound Name | 1-(1-adamantyl)-2-[2-amino-3-(2-morpholin-4-ylethyl)benzimidazol-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 7060423 |
| Molecular Formula | C25H35N4O2+ |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 1-(1-adamantyl)-2-[2-amino-3-(2-morpholin-4-ylethyl)benzimidazol-1-ium-1-yl]ethanone |
| SMILES | Nc1n(CCN2CCOCC2)c2ccccc2[n+]1CC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H34N4O2/c26-24-28(6-5-27-7-9-31-10-8-27)21-3-1-2-4-22(21)29(24)17-23(30)25-14-18-11-19(15-25)13-20(12-18)16-25/h1-4,18-20,26H,5-17H2/p+1 |
| InChIKey | KDTNBYIYXDPGDN-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 64.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|