About 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone
2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone (PubChem CID 2874634) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone |
| PubChem CID | 2874634 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone |
| SMILES | O=C(CN1CCOCC1)C12CC3CCC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H27NO2/c19-16(12-18-3-5-20-6-4-18)17-9-13-1-2-14(10-17)8-15(7-13)11-17/h13-15H,1-12H2 |
| InChIKey | QZWLBNFPJKJSKQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone?
The IUPAC name of 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone (CID 2874634) is 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone.
What is the SMILES notation for 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone?
The canonical SMILES for 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone is O=C(CN1CCOCC1)C12CC3CCC(CC(C3)C1)C2.
What is the InChIKey of 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone?
The InChIKey is QZWLBNFPJKJSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c19-16(12-18-3-5-20-6-4-18)17-9-13-1-2-14(10-17)8-15(7-13)11-17/h13-15H,1-12H2.
What are the key properties of 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone?
2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone has a molecular weight of 277.41 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone is sourced from PubChem (CID 2874634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).